About 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride
1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride (PubChem CID 87102455) has the molecular formula C10H8ClN3
and a molecular weight of 205.65 g/mol. Its IUPAC name is 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride.
Molecular Properties
| Compound Name | 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride |
| PubChem CID | 87102455 |
| Molecular Formula | C10H8ClN3 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride |
| SMILES | C1=CC(C2=C3C=NC=C[NH+]3C=N2)=C1.[Cl-] |
| InChI | InChI=1S/C10H7N3.ClH/c1-2-8(3-1)10-9-6-11-4-5-13(9)7-12-10;/h1-7H;1H |
| InChIKey | TYGPORPXLCJEBW-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 29.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride?
The IUPAC name of 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride (CID 87102455) is 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride.
What is the SMILES notation for 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride?
The canonical SMILES for 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride is C1=CC(C2=C3C=NC=C[NH+]3C=N2)=C1.[Cl-].
What is the InChIKey of 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride?
The InChIKey is TYGPORPXLCJEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3.ClH/c1-2-8(3-1)10-9-6-11-4-5-13(9)7-12-10;/h1-7H;1H.
What are the key properties of 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride?
1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride has a molecular weight of 205.65 g/mol, XLogP of -2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclobutadienyl)-4H-imidazo[1,5-a]pyrazin-4-ium chloride is sourced from PubChem (CID 87102455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).