C20H24FN5O2 — CID 87102865
N-[3-[(4-acetylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-(6-methyl-3-pyridinyl)formamide (PubChem CID 87102865) has the molecular formula C20H24FN5O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[3-[(4-acetylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-(6-methyl-3-pyridinyl)formamide.
| Compound Name | N-[3-[(4-acetylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-(6-methyl-3-pyridinyl)formamide |
|---|---|
| PubChem CID | 87102865 |
| Molecular Formula | C20H24FN5O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[3-[(4-acetylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-(6-methyl-3-pyridinyl)formamide |
| SMILES | CC(=O)N1CCN(Cc2cccc(NN(C=O)c3ccc(C)nc3)c2F)CC1 |
| InChI | InChI=1S/C20H24FN5O2/c1-15-6-7-18(12-22-15)26(14-27)23-19-5-3-4-17(20(19)21)13-24-8-10-25(11-9-24)16(2)28/h3-7,12,14,23H,8-11,13H2,1-2H3 |
| InChIKey | CREOOIJPJHCGFN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|