C32H30N2O6 — CID 87102973
4-[4-[[(2S,3R)-1-oxo-3-phenylmethoxy-1-(phenylmethoxyamino)butan-2-yl]carbamoyl]phenyl]benzoic acid (PubChem CID 87102973) has the molecular formula C32H30N2O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is 4-[4-[[(2S,3R)-1-oxo-3-phenylmethoxy-1-(phenylmethoxyamino)butan-2-yl]carbamoyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[(2S,3R)-1-oxo-3-phenylmethoxy-1-(phenylmethoxyamino)butan-2-yl]carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 87102973 |
| Molecular Formula | C32H30N2O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 4-[4-[[(2S,3R)-1-oxo-3-phenylmethoxy-1-(phenylmethoxyamino)butan-2-yl]carbamoyl]phenyl]benzoic acid |
| SMILES | C[C@@H](OCc1ccccc1)[C@H](NC(=O)c1ccc(-c2ccc(C(=O)O)cc2)cc1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C32H30N2O6/c1-22(39-20-23-8-4-2-5-9-23)29(31(36)34-40-21-24-10-6-3-7-11-24)33-30(35)27-16-12-25(13-17-27)26-14-18-28(19-15-26)32(37)38/h2-19,22,29H,20-21H2,1H3,(H,33,35)(H,34,36)(H,37,38)/t22-,29+/m1/s1 |
| InChIKey | PKCMATSNNPZRKY-MNNSJKJDSA-N |
| XLogP | 5.00 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|