About [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate
[3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate (PubChem CID 87103100) has the molecular formula C13H20O7
and a molecular weight of 288.30 g/mol. Its IUPAC name is [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate |
| PubChem CID | 87103100 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(CO)OC(=O)CCC(C)=O |
| InChI | InChI=1S/C13H20O7/c1-9(15)3-5-12(17)19-8-11(7-14)20-13(18)6-4-10(2)16/h11,14H,3-8H2,1-2H3 |
| InChIKey | ILWVFNNXAHVFCW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate?
The IUPAC name of [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate (CID 87103100) is [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate.
What is the SMILES notation for [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate?
The canonical SMILES for [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate is CC(=O)CCC(=O)OCC(CO)OC(=O)CCC(C)=O.
What is the InChIKey of [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate?
The InChIKey is ILWVFNNXAHVFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O7/c1-9(15)3-5-12(17)19-8-11(7-14)20-13(18)6-4-10(2)16/h11,14H,3-8H2,1-2H3.
What are the key properties of [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate?
[3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate has a molecular weight of 288.30 g/mol, XLogP of 0.17, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-2-(4-oxopentanoyloxy)propyl] 4-oxopentanoate is sourced from PubChem (CID 87103100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).