2-(2,2-diethylhydrazinyl)-2-oxoacetic acid

C6H12N2O3 — CID 87103228

IUPAC2-(2,2-diethylhydrazinyl)-2-oxoacetic acid
SMILESCCN(CC)NC(=O)C(=O)O
InChIInChI=1S/C6H12N2O3/c1-3-8(4-2)7-5(9)6(10)11/h3-4H2,1-2H3,(H,7,9)(H,10,11)
InChIKeyBKVCOWQPPWMXBF-UHFFFAOYSA-N
MW160.17 g/mol
LogP-0.56
Rot. Bonds3

About 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid

2-(2,2-diethylhydrazinyl)-2-oxoacetic acid (PubChem CID 87103228) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(2,2-diethylhydrazinyl)-2-oxoacetic acid
PubChem CID87103228
Molecular FormulaC6H12N2O3
Molecular Weight160.17 g/mol
Exact Mass160.08
IUPAC Name2-(2,2-diethylhydrazinyl)-2-oxoacetic acid
SMILESCCN(CC)NC(=O)C(=O)O
InChIInChI=1S/C6H12N2O3/c1-3-8(4-2)7-5(9)6(10)11/h3-4H2,1-2H3,(H,7,9)(H,10,11)
InChIKeyBKVCOWQPPWMXBF-UHFFFAOYSA-N
XLogP-0.56
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 5-0.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid?
The IUPAC name of 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid (CID 87103228) is 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid.
What is the SMILES notation for 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid?
The canonical SMILES for 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid is CCN(CC)NC(=O)C(=O)O.
What is the InChIKey of 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid?
The InChIKey is BKVCOWQPPWMXBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3/c1-3-8(4-2)7-5(9)6(10)11/h3-4H2,1-2H3,(H,7,9)(H,10,11).
What are the key properties of 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid?
2-(2,2-diethylhydrazinyl)-2-oxoacetic acid has a molecular weight of 160.17 g/mol, XLogP of -0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethylhydrazinyl)-2-oxoacetic acid is sourced from PubChem (CID 87103228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).