C16H23N3O9S2 — CID 87103445
2-[2,4,6-trioxo-3,5-bis[2-(2-sulfanylacetyl)oxyethyl]-1,3,5-triazinan-1-yl]ethyl propanoate (PubChem CID 87103445) has the molecular formula C16H23N3O9S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-[2,4,6-trioxo-3,5-bis[2-(2-sulfanylacetyl)oxyethyl]-1,3,5-triazinan-1-yl]ethyl propanoate.
| Compound Name | 2-[2,4,6-trioxo-3,5-bis[2-(2-sulfanylacetyl)oxyethyl]-1,3,5-triazinan-1-yl]ethyl propanoate |
|---|---|
| PubChem CID | 87103445 |
| Molecular Formula | C16H23N3O9S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-[2,4,6-trioxo-3,5-bis[2-(2-sulfanylacetyl)oxyethyl]-1,3,5-triazinan-1-yl]ethyl propanoate |
| SMILES | CCC(=O)OCCn1c(=O)n(CCOC(=O)CS)c(=O)n(CCOC(=O)CS)c1=O |
| InChI | InChI=1S/C16H23N3O9S2/c1-2-11(20)26-6-3-17-14(23)18(4-7-27-12(21)9-29)16(25)19(15(17)24)5-8-28-13(22)10-30/h29-30H,2-10H2,1H3 |
| InChIKey | HIDYHSNYWYDQSI-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 144.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|