About N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine
N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine (PubChem CID 87103481) has the molecular formula C11H26NO2P
and a molecular weight of 235.31 g/mol. Its IUPAC name is N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine |
| PubChem CID | 87103481 |
| Molecular Formula | C11H26NO2P |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine |
| SMILES | CN(C)P(=O)(OCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H26NO2P/c1-10(2,3)9-14-15(13,12(7)8)11(4,5)6/h9H2,1-8H3 |
| InChIKey | XPDJWMNKYXCLCS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine?
The IUPAC name of N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine (CID 87103481) is N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine.
What is the SMILES notation for N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine?
The canonical SMILES for N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine is CN(C)P(=O)(OCC(C)(C)C)C(C)(C)C.
What is the InChIKey of N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine?
The InChIKey is XPDJWMNKYXCLCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26NO2P/c1-10(2,3)9-14-15(13,12(7)8)11(4,5)6/h9H2,1-8H3.
What are the key properties of N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine?
N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine has a molecular weight of 235.31 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-N-methylmethanamine is sourced from PubChem (CID 87103481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).