C35H32F6N2O6 — CID 87103600
5-[4-[2-[4-[3-carbamoyl-4-(ethoxymethoxy)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(ethoxymethoxy)benzamide (PubChem CID 87103600) has the molecular formula C35H32F6N2O6 and a molecular weight of 690.64 g/mol. Its IUPAC name is 5-[4-[2-[4-[3-carbamoyl-4-(ethoxymethoxy)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(ethoxymethoxy)benzamide.
| Compound Name | 5-[4-[2-[4-[3-carbamoyl-4-(ethoxymethoxy)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(ethoxymethoxy)benzamide |
|---|---|
| PubChem CID | 87103600 |
| Molecular Formula | C35H32F6N2O6 |
| Molecular Weight | 690.64 g/mol |
| Exact Mass | 690.22 |
| IUPAC Name | 5-[4-[2-[4-[3-carbamoyl-4-(ethoxymethoxy)phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(ethoxymethoxy)benzamide |
| SMILES | CCOCOc1ccc(-c2ccc(C(c3ccc(-c4ccc(OCOCC)c(C(N)=O)c4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1C(N)=O |
| InChI | InChI=1S/C35H32F6N2O6/c1-3-46-19-48-29-15-9-23(17-27(29)31(42)44)21-5-11-25(12-6-21)33(34(36,37)38,35(39,40)41)26-13-7-22(8-14-26)24-10-16-30(49-20-47-4-2)28(18-24)32(43)45/h5-18H,3-4,19-20H2,1-2H3,(H2,42,44)(H2,43,45) |
| InChIKey | ZOENDAAKHXTWOV-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|