About dioxido(oxo)silane;bis(2-methoxyethylmercury(1+))
dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) (PubChem CID 87103727) has the molecular formula C6H14Hg2O5Si
and a molecular weight of 595.44 g/mol. Its IUPAC name is dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)).
Molecular Properties
| Compound Name | dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) |
| PubChem CID | 87103727 |
| Molecular Formula | C6H14Hg2O5Si |
| Molecular Weight | 595.44 g/mol |
| Exact Mass | 598.00 |
| IUPAC Name | dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) |
| SMILES | COCC[Hg+].COCC[Hg+].O=[Si]([O-])[O-] |
| InChI | InChI=1S/2C3H7O.2Hg.O3Si/c2*1-3-4-2;;;1-4(2)3/h2*1,3H2,2H3;;;/q;;2*+1;-2 |
| InChIKey | VIJONEIFBHPTPR-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 595.44 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;bis(2-methoxyethylmercury(1+))?
The IUPAC name of dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) (CID 87103727) is dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)).
What is the SMILES notation for dioxido(oxo)silane;bis(2-methoxyethylmercury(1+))?
The canonical SMILES for dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) is COCC[Hg+].COCC[Hg+].O=[Si]([O-])[O-].
What is the InChIKey of dioxido(oxo)silane;bis(2-methoxyethylmercury(1+))?
The InChIKey is VIJONEIFBHPTPR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7O.2Hg.O3Si/c2*1-3-4-2;;;1-4(2)3/h2*1,3H2,2H3;;;/q;;2*+1;-2.
What are the key properties of dioxido(oxo)silane;bis(2-methoxyethylmercury(1+))?
dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) has a molecular weight of 595.44 g/mol, XLogP of -1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;bis(2-methoxyethylmercury(1+)) is sourced from PubChem (CID 87103727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).