About butyl(trimethyl)azanium;trimethyl(octyl)azanium
butyl(trimethyl)azanium;trimethyl(octyl)azanium (PubChem CID 87103767) has the molecular formula C18H44N2+2
and a molecular weight of 288.56 g/mol. Its IUPAC name is butyl(trimethyl)azanium;trimethyl(octyl)azanium.
Molecular Properties
| Compound Name | butyl(trimethyl)azanium;trimethyl(octyl)azanium |
| PubChem CID | 87103767 |
| Molecular Formula | C18H44N2+2 |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 288.35 |
| IUPAC Name | butyl(trimethyl)azanium;trimethyl(octyl)azanium |
| SMILES | CCCCCCCC[N+](C)(C)C.CCCC[N+](C)(C)C |
| InChI | InChI=1S/C11H26N.C7H18N/c1-5-6-7-8-9-10-11-12(2,3)4;1-5-6-7-8(2,3)4/h5-11H2,1-4H3;5-7H2,1-4H3/q2*+1 |
| InChIKey | GBTYHKWBYNTBPH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl(trimethyl)azanium;trimethyl(octyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trimethyl)azanium;trimethyl(octyl)azanium?
The IUPAC name of butyl(trimethyl)azanium;trimethyl(octyl)azanium (CID 87103767) is butyl(trimethyl)azanium;trimethyl(octyl)azanium.
What is the SMILES notation for butyl(trimethyl)azanium;trimethyl(octyl)azanium?
The canonical SMILES for butyl(trimethyl)azanium;trimethyl(octyl)azanium is CCCCCCCC[N+](C)(C)C.CCCC[N+](C)(C)C.
What is the InChIKey of butyl(trimethyl)azanium;trimethyl(octyl)azanium?
The InChIKey is GBTYHKWBYNTBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N.C7H18N/c1-5-6-7-8-9-10-11-12(2,3)4;1-5-6-7-8(2,3)4/h5-11H2,1-4H3;5-7H2,1-4H3/q2*+1.
What are the key properties of butyl(trimethyl)azanium;trimethyl(octyl)azanium?
butyl(trimethyl)azanium;trimethyl(octyl)azanium has a molecular weight of 288.56 g/mol, XLogP of 4.55, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trimethyl)azanium;trimethyl(octyl)azanium is sourced from PubChem (CID 87103767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).