C22H13Cl2F4N7 — CID 87103961
6-(2-chloro-6-fluorophenyl)-4-N-(6-chloro-3-pyridinyl)-2-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 87103961) has the molecular formula C22H13Cl2F4N7 and a molecular weight of 522.29 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-(6-chloro-3-pyridinyl)-2-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-(6-chloro-3-pyridinyl)-2-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87103961 |
| Molecular Formula | C22H13Cl2F4N7 |
| Molecular Weight | 522.29 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-(6-chloro-3-pyridinyl)-2-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1cccc(Cl)c1-c1nc(N/N=C/c2ccc(C(F)(F)F)cc2)nc(Nc2ccc(Cl)nc2)n1 |
| InChI | InChI=1S/C22H13Cl2F4N7/c23-15-2-1-3-16(25)18(15)19-32-20(31-14-8-9-17(24)29-11-14)34-21(33-19)35-30-10-12-4-6-13(7-5-12)22(26,27)28/h1-11H,(H2,31,32,33,34,35)/b30-10+ |
| InChIKey | WLIQLICVKFXXGY-WXMAUWIXSA-N |
| XLogP | 6.59 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.29 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|