C22H32F20O6Si2 — CID 87104205
triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane;trimethoxy(3,3,3-trifluoropropyl)silane (PubChem CID 87104205) has the molecular formula C22H32F20O6Si2 and a molecular weight of 828.62 g/mol. Its IUPAC name is triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane;trimethoxy(3,3,3-trifluoropropyl)silane.
| Compound Name | triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane;trimethoxy(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 87104205 |
| Molecular Formula | C22H32F20O6Si2 |
| Molecular Weight | 828.62 g/mol |
| Exact Mass | 828.14 |
| IUPAC Name | triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane;trimethoxy(3,3,3-trifluoropropyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F.CO[Si](CCC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C16H19F17O3Si.C6H13F3O3Si/c1-4-34-37(35-5-2,36-6-3)10(21)12(24,25)14(28,29)16(32,33)15(30,31)13(26,27)11(22,23)8(18)7(17)9(19)20;1-10-13(11-2,12-3)5-4-6(7,8)9/h7-10H,4-6H2,1-3H3;4-5H2,1-3H3 |
| InChIKey | VOCQFSGCFPONPI-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.62 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|