C40H46N2O6 — CID 87104238
9,10-bis(octylcarbamoyl)perylene-3,4-dicarboxylic acid (PubChem CID 87104238) has the molecular formula C40H46N2O6 and a molecular weight of 650.82 g/mol. Its IUPAC name is 9,10-bis(octylcarbamoyl)perylene-3,4-dicarboxylic acid.
| Compound Name | 9,10-bis(octylcarbamoyl)perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 87104238 |
| Molecular Formula | C40H46N2O6 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | 9,10-bis(octylcarbamoyl)perylene-3,4-dicarboxylic acid |
| SMILES | CCCCCCCCNC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5ccc(C(=O)NCCCCCCCC)c1c25)c43 |
| InChI | InChI=1S/C40H46N2O6/c1-3-5-7-9-11-13-23-41-37(43)29-19-15-25-27-17-21-31(39(45)46)36-32(40(47)48)22-18-28(34(27)36)26-16-20-30(35(29)33(25)26)38(44)42-24-14-12-10-8-6-4-2/h15-22H,3-14,23-24H2,1-2H3,(H,41,43)(H,42,44)(H,45,46)(H,47,48) |
| InChIKey | ULYOATJQTYIRQV-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|