C11H8F8 — CID 87104269
5,6-bis(ethenyl)-1,2,2,3,3,4,7,7-octafluorobicyclo[2.2.1]heptane (PubChem CID 87104269) has the molecular formula C11H8F8 and a molecular weight of 292.17 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-1,2,2,3,3,4,7,7-octafluorobicyclo[2.2.1]heptane.
| Compound Name | 5,6-bis(ethenyl)-1,2,2,3,3,4,7,7-octafluorobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 87104269 |
| Molecular Formula | C11H8F8 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5,6-bis(ethenyl)-1,2,2,3,3,4,7,7-octafluorobicyclo[2.2.1]heptane |
| SMILES | C=CC1C(C=C)C2(F)C(F)(F)C(F)(F)C1(F)C2(F)F |
| InChI | InChI=1S/C11H8F8/c1-3-5-6(4-2)8(13)9(14,15)7(5,12)10(16,17)11(8,18)19/h3-6H,1-2H2 |
| InChIKey | SLAYFLGVZCMEDM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|