C11H6F10 — CID 87104270
2,3-bis(ethenyl)-1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane (PubChem CID 87104270) has the molecular formula C11H6F10 and a molecular weight of 328.15 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane.
| Compound Name | 2,3-bis(ethenyl)-1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 87104270 |
| Molecular Formula | C11H6F10 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2,3-bis(ethenyl)-1,2,3,4,5,5,6,6,7,7-decafluorobicyclo[2.2.1]heptane |
| SMILES | C=CC1(F)C(F)(C=C)C2(F)C(F)(F)C(F)(F)C1(F)C2(F)F |
| InChI | InChI=1S/C11H6F10/c1-3-5(12)6(13,4-2)8(15)9(16,17)7(5,14)10(18,19)11(8,20)21/h3-4H,1-2H2 |
| InChIKey | FFEPFBZTQXAWQL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|