C9H10F11NOS — CID 87104313
2-[3,3,4,4-tetrafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butyl]sulfanylethanamine (PubChem CID 87104313) has the molecular formula C9H10F11NOS and a molecular weight of 389.23 g/mol. Its IUPAC name is 2-[3,3,4,4-tetrafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butyl]sulfanylethanamine.
| Compound Name | 2-[3,3,4,4-tetrafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butyl]sulfanylethanamine |
|---|---|
| PubChem CID | 87104313 |
| Molecular Formula | C9H10F11NOS |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-[3,3,4,4-tetrafluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)butyl]sulfanylethanamine |
| SMILES | NCCSCCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F11NOS/c10-5(11,1-3-23-4-2-21)8(17,18)22-9(19,20)6(12,13)7(14,15)16/h1-4,21H2 |
| InChIKey | SMUQAHYSAIQWNW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|