C14H4F20 — CID 87104326
6-ethenyl-2,2,3,3,4-pentafluoro-1,5,5,7,7-pentakis(trifluoromethyl)bicyclo[2.2.1]heptane (PubChem CID 87104326) has the molecular formula C14H4F20 and a molecular weight of 552.15 g/mol. Its IUPAC name is 6-ethenyl-2,2,3,3,4-pentafluoro-1,5,5,7,7-pentakis(trifluoromethyl)bicyclo[2.2.1]heptane.
| Compound Name | 6-ethenyl-2,2,3,3,4-pentafluoro-1,5,5,7,7-pentakis(trifluoromethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 87104326 |
| Molecular Formula | C14H4F20 |
| Molecular Weight | 552.15 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | 6-ethenyl-2,2,3,3,4-pentafluoro-1,5,5,7,7-pentakis(trifluoromethyl)bicyclo[2.2.1]heptane |
| SMILES | C=CC1C(C(F)(F)F)(C(F)(F)F)C2(F)C(F)(F)C(F)(F)C1(C(F)(F)F)C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H4F20/c1-2-3-4(10(20,21)22)6(13(29,30)31,14(32,33)34)7(15,9(18,19)8(4,16)17)5(3,11(23,24)25)12(26,27)28/h2-3H,1H2 |
| InChIKey | HUVWQWPZDMZWHI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.15 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|