About 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide
4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 871044) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide |
| PubChem CID | 871044 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C10H10N4O/c1-7-2-4-8(5-3-7)9(15)13-10-11-6-12-14-10/h2-6H,1H3,(H2,11,12,13,14,15) |
| InChIKey | QJNGEUXMEXYZNP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide?
The IUPAC name of 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide (CID 871044) is 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide.
What is the SMILES notation for 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide?
The canonical SMILES for 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide is Cc1ccc(C(=O)Nc2ncn[nH]2)cc1.
What is the InChIKey of 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide?
The InChIKey is QJNGEUXMEXYZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c1-7-2-4-8(5-3-7)9(15)13-10-11-6-12-14-10/h2-6H,1H3,(H2,11,12,13,14,15).
What are the key properties of 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide?
4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide has a molecular weight of 202.22 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(1H-1,2,4-triazol-5-yl)benzamide is sourced from PubChem (CID 871044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).