C12H4F16 — CID 87104449
6-ethenyl-2,2,3,3,4,5,5-heptafluoro-1,7,7-tris(trifluoromethyl)bicyclo[2.2.1]heptane (PubChem CID 87104449) has the molecular formula C12H4F16 and a molecular weight of 452.13 g/mol. Its IUPAC name is 6-ethenyl-2,2,3,3,4,5,5-heptafluoro-1,7,7-tris(trifluoromethyl)bicyclo[2.2.1]heptane.
| Compound Name | 6-ethenyl-2,2,3,3,4,5,5-heptafluoro-1,7,7-tris(trifluoromethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 87104449 |
| Molecular Formula | C12H4F16 |
| Molecular Weight | 452.13 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 6-ethenyl-2,2,3,3,4,5,5-heptafluoro-1,7,7-tris(trifluoromethyl)bicyclo[2.2.1]heptane |
| SMILES | C=CC1C(F)(F)C2(F)C(F)(F)C(F)(F)C1(C(F)(F)F)C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H4F16/c1-2-3-4(10(20,21)22)6(11(23,24)25,12(26,27)28)7(15,5(3,13)14)9(18,19)8(4,16)17/h2-3H,1H2 |
| InChIKey | YONGHDTVCXCXNH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.13 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|