C19H39N3O4Si — CID 87104517
[1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopentyl]-2,2-dimethylpropyl]carbamic acid (PubChem CID 87104517) has the molecular formula C19H39N3O4Si and a molecular weight of 401.62 g/mol. Its IUPAC name is [1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopentyl]-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopentyl]-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 87104517 |
| Molecular Formula | C19H39N3O4Si |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | [1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopentyl]-2,2-dimethylpropyl]carbamic acid |
| SMILES | CC(C)(C)C(NC(=O)O)C1(/C(N)=N\O)CCC(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H39N3O4Si/c1-17(2,3)14(21-16(23)24)19(15(20)22-25)10-9-13(11-19)12-26-27(7,8)18(4,5)6/h13-14,21,25H,9-12H2,1-8H3,(H2,20,22)(H,23,24) |
| InChIKey | MHVYKKGQQAJOJD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|