C6H8Cl6O — CID 87104544
1,1,1-trichloro-3-(3,3,3-trichloropropoxy)propane (PubChem CID 87104544) has the molecular formula C6H8Cl6O and a molecular weight of 308.85 g/mol. Its IUPAC name is 1,1,1-trichloro-3-(3,3,3-trichloropropoxy)propane.
| Compound Name | 1,1,1-trichloro-3-(3,3,3-trichloropropoxy)propane |
|---|---|
| PubChem CID | 87104544 |
| Molecular Formula | C6H8Cl6O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 305.87 |
| IUPAC Name | 1,1,1-trichloro-3-(3,3,3-trichloropropoxy)propane |
| SMILES | ClC(Cl)(Cl)CCOCCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl6O/c7-5(8,9)1-3-13-4-2-6(10,11)12/h1-4H2 |
| InChIKey | CABMGLVFFBFGLF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|