C8H12O3S — CID 87104570
5-ethenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide (PubChem CID 87104570) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is 5-ethenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide.
| Compound Name | 5-ethenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide |
|---|---|
| PubChem CID | 87104570 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 5-ethenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide |
| SMILES | C=CC1CCC2OS(=O)OC2C1 |
| InChI | InChI=1S/C8H12O3S/c1-2-6-3-4-7-8(5-6)11-12(9)10-7/h2,6-8H,1,3-5H2 |
| InChIKey | CHWPCLXWMABXOW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|