C33H53NO4 — CID 87104692
[(3S,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-[hydroxy(methyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate (PubChem CID 87104692) has the molecular formula C33H53NO4 and a molecular weight of 527.79 g/mol. Its IUPAC name is [(3S,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-[hydroxy(methyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate.
| Compound Name | [(3S,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-[hydroxy(methyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 87104692 |
| Molecular Formula | C33H53NO4 |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.40 |
| IUPAC Name | [(3S,6aR,6bS,8aS,11S,12aR,14aR,14bR)-11-[hydroxy(methyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)[C@@H]2CC=C2[C@@H]4C[C@@](C)(C(=O)N(C)O)CC[C@]4(C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C33H53NO4/c1-21(35)38-26-13-14-31(6)24(28(26,2)3)12-15-33(8)25(31)11-10-22-23-20-30(5,27(36)34(9)37)17-16-29(23,4)18-19-32(22,33)7/h10,23-26,37H,11-20H2,1-9H3/t23-,24?,25+,26-,29+,30-,31-,32+,33+/m0/s1 |
| InChIKey | DRDYBGPPPVVGCK-CAOIZRNRSA-N |
| XLogP | 7.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|