About 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium
1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium (PubChem CID 87104757) has the molecular formula C7H7F6N2O+
and a molecular weight of 249.13 g/mol. Its IUPAC name is 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium.
Molecular Properties
| Compound Name | 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium |
| PubChem CID | 87104757 |
| Molecular Formula | C7H7F6N2O+ |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium |
| SMILES | C[n+]1ccn(C(F)(F)C(F)OC(F)(F)F)c1 |
| InChI | InChI=1S/C7H7F6N2O/c1-14-2-3-15(4-14)6(9,10)5(8)16-7(11,12)13/h2-5H,1H3/q+1 |
| InChIKey | SJFRXJVEMFKGLL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium?
The IUPAC name of 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium (CID 87104757) is 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium.
What is the SMILES notation for 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium?
The canonical SMILES for 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium is C[n+]1ccn(C(F)(F)C(F)OC(F)(F)F)c1.
What is the InChIKey of 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium?
The InChIKey is SJFRXJVEMFKGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F6N2O/c1-14-2-3-15(4-14)6(9,10)5(8)16-7(11,12)13/h2-5H,1H3/q+1.
What are the key properties of 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium?
1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium has a molecular weight of 249.13 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazol-1-ium is sourced from PubChem (CID 87104757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).