About 2-methylprop-2-eneperoxoic acid;oxepan-2-one
2-methylprop-2-eneperoxoic acid;oxepan-2-one (PubChem CID 87105082) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-methylprop-2-eneperoxoic acid;oxepan-2-one.
Molecular Properties
| Compound Name | 2-methylprop-2-eneperoxoic acid;oxepan-2-one |
| PubChem CID | 87105082 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-methylprop-2-eneperoxoic acid;oxepan-2-one |
| SMILES | C=C(C)C(=O)OO.O=C1CCCCCO1 |
| InChI | InChI=1S/C6H10O2.C4H6O3/c7-6-4-2-1-3-5-8-6;1-3(2)4(5)7-6/h1-5H2;6H,1H2,2H3 |
| InChIKey | MRDYFZHDGORBSN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-eneperoxoic acid;oxepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-eneperoxoic acid;oxepan-2-one?
The IUPAC name of 2-methylprop-2-eneperoxoic acid;oxepan-2-one (CID 87105082) is 2-methylprop-2-eneperoxoic acid;oxepan-2-one.
What is the SMILES notation for 2-methylprop-2-eneperoxoic acid;oxepan-2-one?
The canonical SMILES for 2-methylprop-2-eneperoxoic acid;oxepan-2-one is C=C(C)C(=O)OO.O=C1CCCCCO1.
What is the InChIKey of 2-methylprop-2-eneperoxoic acid;oxepan-2-one?
The InChIKey is MRDYFZHDGORBSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C4H6O3/c7-6-4-2-1-3-5-8-6;1-3(2)4(5)7-6/h1-5H2;6H,1H2,2H3.
What are the key properties of 2-methylprop-2-eneperoxoic acid;oxepan-2-one?
2-methylprop-2-eneperoxoic acid;oxepan-2-one has a molecular weight of 216.23 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-eneperoxoic acid;oxepan-2-one is sourced from PubChem (CID 87105082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).