C22H25N11 — CID 87105342
3-[[4,6-bis[bis(2-cyanoethyl)amino]-1,3,5-triazin-2-yl]-but-3-ynylamino]propanenitrile (PubChem CID 87105342) has the molecular formula C22H25N11 and a molecular weight of 443.52 g/mol. Its IUPAC name is 3-[[4,6-bis[bis(2-cyanoethyl)amino]-1,3,5-triazin-2-yl]-but-3-ynylamino]propanenitrile.
| Compound Name | 3-[[4,6-bis[bis(2-cyanoethyl)amino]-1,3,5-triazin-2-yl]-but-3-ynylamino]propanenitrile |
|---|---|
| PubChem CID | 87105342 |
| Molecular Formula | C22H25N11 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 3-[[4,6-bis[bis(2-cyanoethyl)amino]-1,3,5-triazin-2-yl]-but-3-ynylamino]propanenitrile |
| SMILES | C#CCCN(CCC#N)c1nc(N(CCC#N)CCC#N)nc(N(CCC#N)CCC#N)n1 |
| InChI | InChI=1S/C22H25N11/c1-2-3-14-31(15-4-9-23)20-28-21(32(16-5-10-24)17-6-11-25)30-22(29-20)33(18-7-12-26)19-8-13-27/h1H,3-8,14-19H2 |
| InChIKey | PRLCGUSGZFAGML-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 167.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|