C10H9F10N2O+ — CID 87105368
1,2-dimethyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]imidazol-1-ium (PubChem CID 87105368) has the molecular formula C10H9F10N2O+ and a molecular weight of 363.18 g/mol. Its IUPAC name is 1,2-dimethyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]imidazol-1-ium.
| Compound Name | 1,2-dimethyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]imidazol-1-ium |
|---|---|
| PubChem CID | 87105368 |
| Molecular Formula | C10H9F10N2O+ |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1,2-dimethyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]imidazol-1-ium |
| SMILES | Cc1n(C(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)cc[n+]1C |
| InChI | InChI=1S/C10H9F10N2O/c1-5-21(2)3-4-22(5)7(12,13)6(11)23-10(19,20)8(14,15)9(16,17)18/h3-4,6H,1-2H3/q+1 |
| InChIKey | JRTWQZYXVURSJH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|