C14H24N2O2 — CID 87105461
N,N-bis(prop-2-enyl)prop-2-en-1-amine;2-(prop-2-enylamino)acetic acid (PubChem CID 87105461) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)prop-2-en-1-amine;2-(prop-2-enylamino)acetic acid.
| Compound Name | N,N-bis(prop-2-enyl)prop-2-en-1-amine;2-(prop-2-enylamino)acetic acid |
|---|---|
| PubChem CID | 87105461 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N,N-bis(prop-2-enyl)prop-2-en-1-amine;2-(prop-2-enylamino)acetic acid |
| SMILES | C=CCN(CC=C)CC=C.C=CCNCC(=O)O |
| InChI | InChI=1S/C9H15N.C5H9NO2/c1-4-7-10(8-5-2)9-6-3;1-2-3-6-4-5(7)8/h4-6H,1-3,7-9H2;2,6H,1,3-4H2,(H,7,8) |
| InChIKey | UMBBUQDUUXIHNM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|