C18H16F5NO — CID 87105864
2,2,3,3-tetrafluoro-5-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine (PubChem CID 87105864) has the molecular formula C18H16F5NO and a molecular weight of 357.32 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-5-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine.
| Compound Name | 2,2,3,3-tetrafluoro-5-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 87105864 |
| Molecular Formula | C18H16F5NO |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2,2,3,3-tetrafluoro-5-(3-fluorophenyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine |
| SMILES | COc1ccc(CN2C(c3cccc(F)c3)CC(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C18H16F5NO/c1-25-15-7-5-12(6-8-15)11-24-16(10-17(20,21)18(24,22)23)13-3-2-4-14(19)9-13/h2-9,16H,10-11H2,1H3 |
| InChIKey | LBYSONUSLYDJQO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|