About ethane-1,2-diol;pentalene
ethane-1,2-diol;pentalene (PubChem CID 87106064) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is ethane-1,2-diol;pentalene.
Molecular Properties
| Compound Name | ethane-1,2-diol;pentalene |
| PubChem CID | 87106064 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | ethane-1,2-diol;pentalene |
| SMILES | C1=CC2=CC=CC2=C1.OCCO |
| InChI | InChI=1S/C8H6.C2H6O2/c1-3-7-5-2-6-8(7)4-1;3-1-2-4/h1-6H;3-4H,1-2H2 |
| InChIKey | MGNHLIJRPUPEIY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane-1,2-diol;pentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;pentalene?
The IUPAC name of ethane-1,2-diol;pentalene (CID 87106064) is ethane-1,2-diol;pentalene.
What is the SMILES notation for ethane-1,2-diol;pentalene?
The canonical SMILES for ethane-1,2-diol;pentalene is C1=CC2=CC=CC2=C1.OCCO.
What is the InChIKey of ethane-1,2-diol;pentalene?
The InChIKey is MGNHLIJRPUPEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6.C2H6O2/c1-3-7-5-2-6-8(7)4-1;3-1-2-4/h1-6H;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;pentalene?
ethane-1,2-diol;pentalene has a molecular weight of 164.20 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;pentalene is sourced from PubChem (CID 87106064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).