About 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene
5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene (PubChem CID 87106570) has the molecular formula C6H2ClF5
and a molecular weight of 204.52 g/mol. Its IUPAC name is 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene.
Analyze 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene?
The IUPAC name of 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene (CID 87106570) is 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene.
What is the SMILES notation for 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene?
The canonical SMILES for 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene is C=C=C(F)C(F)(F)C(Cl)=C(F)F.
What is the InChIKey of 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene?
The InChIKey is MUCCJVKCPCNNLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF5/c1-2-3(8)6(11,12)4(7)5(9)10/h1H2.
What are the key properties of 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene?
5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene has a molecular weight of 204.52 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,4,4,6,6-pentafluorohexa-1,2,5-triene is sourced from PubChem (CID 87106570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).