C23H28N2O2S — CID 87106742
3-[(E)-3-(dimethylamino)prop-2-enethioyl]-N-(1-methoxypropan-2-yl)-5-(4-methylphenyl)benzamide (PubChem CID 87106742) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 3-[(E)-3-(dimethylamino)prop-2-enethioyl]-N-(1-methoxypropan-2-yl)-5-(4-methylphenyl)benzamide.
| Compound Name | 3-[(E)-3-(dimethylamino)prop-2-enethioyl]-N-(1-methoxypropan-2-yl)-5-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 87106742 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-[(E)-3-(dimethylamino)prop-2-enethioyl]-N-(1-methoxypropan-2-yl)-5-(4-methylphenyl)benzamide |
| SMILES | COCC(C)NC(=O)c1cc(C(=S)/C=C/N(C)C)cc(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H28N2O2S/c1-16-6-8-18(9-7-16)19-12-20(22(28)10-11-25(3)4)14-21(13-19)23(26)24-17(2)15-27-5/h6-14,17H,15H2,1-5H3,(H,24,26)/b11-10+ |
| InChIKey | CAFHXEQUXGVOCY-ZHACJKMWSA-N |
| XLogP | 4.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|