C17H21F4NO4 — CID 87106901
[2-fluoro-3-(trifluoromethyl)benzoyl]-(2,4,4-trimethylpentan-2-yloxy)carbamic acid (PubChem CID 87106901) has the molecular formula C17H21F4NO4 and a molecular weight of 379.35 g/mol. Its IUPAC name is [2-fluoro-3-(trifluoromethyl)benzoyl]-(2,4,4-trimethylpentan-2-yloxy)carbamic acid.
| Compound Name | [2-fluoro-3-(trifluoromethyl)benzoyl]-(2,4,4-trimethylpentan-2-yloxy)carbamic acid |
|---|---|
| PubChem CID | 87106901 |
| Molecular Formula | C17H21F4NO4 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [2-fluoro-3-(trifluoromethyl)benzoyl]-(2,4,4-trimethylpentan-2-yloxy)carbamic acid |
| SMILES | CC(C)(C)CC(C)(C)ON(C(=O)O)C(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C17H21F4NO4/c1-15(2,3)9-16(4,5)26-22(14(24)25)13(23)10-7-6-8-11(12(10)18)17(19,20)21/h6-8H,9H2,1-5H3,(H,24,25) |
| InChIKey | JDJYVHWWVJTDEG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|