C43H41ClF3N8O5P — CID 87107125
N-[9-[(2R,6S)-6-[[chloro-[4-[(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]benzamide (PubChem CID 87107125) has the molecular formula C43H41ClF3N8O5P and a molecular weight of 873.27 g/mol. Its IUPAC name is N-[9-[(2R,6S)-6-[[chloro-[4-[(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,6S)-6-[[chloro-[4-[(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 87107125 |
| Molecular Formula | C43H41ClF3N8O5P |
| Molecular Weight | 873.27 g/mol |
| Exact Mass | 872.26 |
| IUPAC Name | N-[9-[(2R,6S)-6-[[chloro-[4-[(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]phosphoryl]oxymethyl]-4-tritylmorpholin-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H](COP(=O)(Cl)N2CCC(NC(=O)C(F)(F)F)CC2)O1)c1ccccc1 |
| InChI | InChI=1S/C43H41ClF3N8O5P/c44-61(58,54-23-21-34(22-24-54)51-41(57)43(45,46)47)59-27-35-25-53(42(31-15-7-2-8-16-31,32-17-9-3-10-18-32)33-19-11-4-12-20-33)26-36(60-35)55-29-50-37-38(48-28-49-39(37)55)52-40(56)30-13-5-1-6-14-30/h1-20,28-29,34-36H,21-27H2,(H,51,57)(H,48,49,52,56)/t35-,36+,61?/m0/s1 |
| InChIKey | GDLGEQJPRZLIKJ-BWHYLFCFSA-N |
| XLogP | 7.78 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.27 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|