About 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium
2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium (PubChem CID 87107389) has the molecular formula C13H22O5Zr
and a molecular weight of 349.54 g/mol. Its IUPAC name is 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium.
Molecular Properties
| Compound Name | 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium |
| PubChem CID | 87107389 |
| Molecular Formula | C13H22O5Zr |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium |
| SMILES | CC(=O)/C=C(/C)O.CCC(CC)(C(C)=O)C(=O)O.[Zr] |
| InChI | InChI=1S/C8H14O3.C5H8O2.Zr/c1-4-8(5-2,6(3)9)7(10)11;1-4(6)3-5(2)7;/h4-5H2,1-3H3,(H,10,11);3,6H,1-2H3;/b;4-3-; |
| InChIKey | VSQRZKVTQKJTEW-LWFKIUJUSA-N |
| XLogP | 2.50 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium?
The IUPAC name of 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium (CID 87107389) is 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium.
What is the SMILES notation for 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium?
The canonical SMILES for 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium is CC(=O)/C=C(/C)O.CCC(CC)(C(C)=O)C(=O)O.[Zr].
What is the InChIKey of 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium?
The InChIKey is VSQRZKVTQKJTEW-LWFKIUJUSA-N. The full InChI is InChI=1S/C8H14O3.C5H8O2.Zr/c1-4-8(5-2,6(3)9)7(10)11;1-4(6)3-5(2)7;/h4-5H2,1-3H3,(H,10,11);3,6H,1-2H3;/b;4-3-;.
What are the key properties of 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium?
2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium has a molecular weight of 349.54 g/mol, XLogP of 2.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one;zirconium is sourced from PubChem (CID 87107389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).