About CID 87107751
CID 87107751 (PubChem CID 87107751) has the molecular formula C6H12N2O2Se2
and a molecular weight of 302.09 g/mol.
Molecular Properties
| Compound Name | CID 87107751 |
| PubChem CID | 87107751 |
| Molecular Formula | C6H12N2O2Se2 |
| Molecular Weight | 302.09 g/mol |
| Exact Mass | 303.92 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)[Se].NC(=O)[Se] |
| InChI | InChI=1S/C5H10NOSe.CH2NOSe/c1-3-6(4-2)5(7)8;2-1(3)4/h3-4H2,1-2H3;(H2,2,3) |
| InChIKey | TWUQESWZNBDSDV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.09 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87107751 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87107751?
The IUPAC name of CID 87107751 (CID 87107751) is not available.
What is the SMILES notation for CID 87107751?
The canonical SMILES for CID 87107751 is CCN(CC)C(=O)[Se].NC(=O)[Se].
What is the InChIKey of CID 87107751?
The InChIKey is TWUQESWZNBDSDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NOSe.CH2NOSe/c1-3-6(4-2)5(7)8;2-1(3)4/h3-4H2,1-2H3;(H2,2,3).
What are the key properties of CID 87107751?
CID 87107751 has a molecular weight of 302.09 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87107751 is sourced from PubChem (CID 87107751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).