C15H12Br2 — CID 87107804
14,15-dibromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11-hexaene (PubChem CID 87107804) has the molecular formula C15H12Br2 and a molecular weight of 352.07 g/mol. Its IUPAC name is 14,15-dibromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11-hexaene.
| Compound Name | 14,15-dibromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 87107804 |
| Molecular Formula | C15H12Br2 |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 14,15-dibromotricyclo[9.4.0.02,7]pentadeca-1,3,5,7,9,11-hexaene |
| SMILES | BrC1CC=C2C=CC=c3ccccc3=C2C1Br |
| InChI | InChI=1S/C15H12Br2/c16-13-9-8-11-6-3-5-10-4-1-2-7-12(10)14(11)15(13)17/h1-8,13,15H,9H2 |
| InChIKey | OZZCJKIWRVXJMG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|