About 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid
4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid (PubChem CID 87107917) has the molecular formula C9H11F3O5
and a molecular weight of 256.18 g/mol. Its IUPAC name is 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid.
Molecular Properties
| Compound Name | 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid |
| PubChem CID | 87107917 |
| Molecular Formula | C9H11F3O5 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid |
| SMILES | C=CCOC(F)(OCC)C(=O)C(F)(F)C(=O)O |
| InChI | InChI=1S/C9H11F3O5/c1-3-5-17-9(12,16-4-2)6(13)8(10,11)7(14)15/h3H,1,4-5H2,2H3,(H,14,15) |
| InChIKey | IXJWETMTIVCTGO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid?
The IUPAC name of 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid (CID 87107917) is 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid.
What is the SMILES notation for 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid?
The canonical SMILES for 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid is C=CCOC(F)(OCC)C(=O)C(F)(F)C(=O)O.
What is the InChIKey of 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid?
The InChIKey is IXJWETMTIVCTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O5/c1-3-5-17-9(12,16-4-2)6(13)8(10,11)7(14)15/h3H,1,4-5H2,2H3,(H,14,15).
What are the key properties of 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid?
4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid has a molecular weight of 256.18 g/mol, XLogP of 1.14, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2,2,4-trifluoro-3-oxo-4-prop-2-enoxybutanoic acid is sourced from PubChem (CID 87107917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).