About 6-nitrohex-3-enamide
6-nitrohex-3-enamide (PubChem CID 87108536) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 6-nitrohex-3-enamide.
Molecular Properties
| Compound Name | 6-nitrohex-3-enamide |
| PubChem CID | 87108536 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 6-nitrohex-3-enamide |
| SMILES | NC(=O)CC=CCC[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N2O3/c7-6(9)4-2-1-3-5-8(10)11/h1-2H,3-5H2,(H2,7,9) |
| InChIKey | UMTBRIHHNYJDMQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitrohex-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitrohex-3-enamide?
The IUPAC name of 6-nitrohex-3-enamide (CID 87108536) is 6-nitrohex-3-enamide.
What is the SMILES notation for 6-nitrohex-3-enamide?
The canonical SMILES for 6-nitrohex-3-enamide is NC(=O)CC=CCC[N+](=O)[O-].
What is the InChIKey of 6-nitrohex-3-enamide?
The InChIKey is UMTBRIHHNYJDMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c7-6(9)4-2-1-3-5-8(10)11/h1-2H,3-5H2,(H2,7,9).
What are the key properties of 6-nitrohex-3-enamide?
6-nitrohex-3-enamide has a molecular weight of 158.16 g/mol, XLogP of 0.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitrohex-3-enamide is sourced from PubChem (CID 87108536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).