C10H6F10O — CID 87108583
1,3,3,4,4,5,5-heptafluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene (PubChem CID 87108583) has the molecular formula C10H6F10O and a molecular weight of 332.14 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene |
|---|---|
| PubChem CID | 87108583 |
| Molecular Formula | C10H6F10O |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-(1,1,1-trifluoropent-4-en-2-yloxy)cyclopentene |
| SMILES | C=CCC(OC1=C(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F10O/c1-2-3-4(9(16,17)18)21-6-5(11)7(12,13)10(19,20)8(6,14)15/h2,4H,1,3H2 |
| InChIKey | UYYMWEKJWDJOBY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|