About 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol
1-[1,1-bis(dimethylamino)propylamino]propan-2-ol (PubChem CID 87108795) has the molecular formula C10H25N3O
and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol |
| PubChem CID | 87108795 |
| Molecular Formula | C10H25N3O |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.20 |
| IUPAC Name | 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol |
| SMILES | CCC(NCC(C)O)(N(C)C)N(C)C |
| InChI | InChI=1S/C10H25N3O/c1-7-10(12(3)4,13(5)6)11-8-9(2)14/h9,11,14H,7-8H2,1-6H3 |
| InChIKey | HDDXIEUHSMTYBT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol?
The IUPAC name of 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol (CID 87108795) is 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol.
What is the SMILES notation for 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol?
The canonical SMILES for 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol is CCC(NCC(C)O)(N(C)C)N(C)C.
What is the InChIKey of 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol?
The InChIKey is HDDXIEUHSMTYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25N3O/c1-7-10(12(3)4,13(5)6)11-8-9(2)14/h9,11,14H,7-8H2,1-6H3.
What are the key properties of 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol?
1-[1,1-bis(dimethylamino)propylamino]propan-2-ol has a molecular weight of 203.33 g/mol, XLogP of 0.14, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,1-bis(dimethylamino)propylamino]propan-2-ol is sourced from PubChem (CID 87108795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).