C27H34F4O4S2 — CID 87108847
[1-(6-butoxynaphthalen-2-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87108847) has the molecular formula C27H34F4O4S2 and a molecular weight of 562.69 g/mol. Its IUPAC name is [1-(6-butoxynaphthalen-2-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | [1-(6-butoxynaphthalen-2-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87108847 |
| Molecular Formula | C27H34F4O4S2 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | [1-(6-butoxynaphthalen-2-yl)thiolan-1-yl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCCCOc1ccc2cc(S3(OS(=O)(=O)C(F)(F)C(F)(F)C4CC5CCC4C5)CCCC3)ccc2c1 |
| InChI | InChI=1S/C27H34F4O4S2/c1-2-3-12-34-23-10-8-21-18-24(11-9-20(21)17-23)36(13-4-5-14-36)35-37(32,33)27(30,31)26(28,29)25-16-19-6-7-22(25)15-19/h8-11,17-19,22,25H,2-7,12-16H2,1H3 |
| InChIKey | YOGZQWULWRWVSX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|