C29H32O6S3 — CID 87108853
(4-methylsulfonylphenyl)-diphenylsulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate (PubChem CID 87108853) has the molecular formula C29H32O6S3 and a molecular weight of 572.77 g/mol. Its IUPAC name is (4-methylsulfonylphenyl)-diphenylsulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate.
| Compound Name | (4-methylsulfonylphenyl)-diphenylsulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
|---|---|
| PubChem CID | 87108853 |
| Molecular Formula | C29H32O6S3 |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | (4-methylsulfonylphenyl)-diphenylsulfanium;4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
| SMILES | CC12CCC(C(S(=O)(=O)[O-])C1=O)C2(C)C.CS(=O)(=O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17O2S2.C10H16O4S/c1-23(20,21)19-14-12-18(13-15-19)22(16-8-4-2-5-9-16)17-10-6-3-7-11-17;1-9(2)6-4-5-10(9,3)8(11)7(6)15(12,13)14/h2-15H,1H3;6-7H,4-5H2,1-3H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | OTJCWGQFYQTKLE-UHFFFAOYSA-M |
| XLogP | 5.11 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|