About 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide
6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide (PubChem CID 87109245) has the molecular formula C27H26F2N2O3
and a molecular weight of 464.51 g/mol. Its IUPAC name is 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide.
Molecular Properties
| Compound Name | 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide |
| PubChem CID | 87109245 |
| Molecular Formula | C27H26F2N2O3 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide |
| SMILES | O=C(CCCCCN1Cc2c(cccc2-c2cc(F)cc(F)c2)C1=O)NOCc1ccccc1 |
| InChI | InChI=1S/C27H26F2N2O3/c28-21-14-20(15-22(29)16-21)23-10-7-11-24-25(23)17-31(27(24)33)13-6-2-5-12-26(32)30-34-18-19-8-3-1-4-9-19/h1,3-4,7-11,14-16H,2,5-6,12-13,17-18H2,(H,30,32) |
| InChIKey | YYPNKNQDVKPAOF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
The IUPAC name of 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide (CID 87109245) is 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide.
What is the SMILES notation for 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
The canonical SMILES for 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide is O=C(CCCCCN1Cc2c(cccc2-c2cc(F)cc(F)c2)C1=O)NOCc1ccccc1.
What is the InChIKey of 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
The InChIKey is YYPNKNQDVKPAOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26F2N2O3/c28-21-14-20(15-22(29)16-21)23-10-7-11-24-25(23)17-31(27(24)33)13-6-2-5-12-26(32)30-34-18-19-8-3-1-4-9-19/h1,3-4,7-11,14-16H,2,5-6,12-13,17-18H2,(H,30,32).
What are the key properties of 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide has a molecular weight of 464.51 g/mol, XLogP of 5.40, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[7-(3,5-difluorophenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide is sourced from PubChem (CID 87109245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).