About carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid
carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid (PubChem CID 87109326) has the molecular formula C6H13N3S4
and a molecular weight of 255.46 g/mol. Its IUPAC name is carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid.
Molecular Properties
| Compound Name | carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid |
| PubChem CID | 87109326 |
| Molecular Formula | C6H13N3S4 |
| Molecular Weight | 255.46 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid |
| SMILES | NC(=S)S.S=C(S)NN1CCCC1 |
| InChI | InChI=1S/C5H10N2S2.CH3NS2/c8-5(9)6-7-3-1-2-4-7;2-1(3)4/h1-4H2,(H2,6,8,9);(H3,2,3,4) |
| InChIKey | ORXDRRQXNJWZQQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid?
The IUPAC name of carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid (CID 87109326) is carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid.
What is the SMILES notation for carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid?
The canonical SMILES for carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid is NC(=S)S.S=C(S)NN1CCCC1.
What is the InChIKey of carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid?
The InChIKey is ORXDRRQXNJWZQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2S2.CH3NS2/c8-5(9)6-7-3-1-2-4-7;2-1(3)4/h1-4H2,(H2,6,8,9);(H3,2,3,4).
What are the key properties of carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid?
carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid has a molecular weight of 255.46 g/mol, XLogP of 0.96, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamodithioic acid;pyrrolidin-1-ylcarbamodithioic acid is sourced from PubChem (CID 87109326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).