C28H29F3N2O3 — CID 87109349
6-[3-oxo-6-(2,3,4-trifluoro-4-methylcyclohexa-2,5-dien-1-yl)-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide (PubChem CID 87109349) has the molecular formula C28H29F3N2O3 and a molecular weight of 498.55 g/mol. Its IUPAC name is 6-[3-oxo-6-(2,3,4-trifluoro-4-methylcyclohexa-2,5-dien-1-yl)-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide.
| Compound Name | 6-[3-oxo-6-(2,3,4-trifluoro-4-methylcyclohexa-2,5-dien-1-yl)-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 87109349 |
| Molecular Formula | C28H29F3N2O3 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 6-[3-oxo-6-(2,3,4-trifluoro-4-methylcyclohexa-2,5-dien-1-yl)-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide |
| SMILES | CC1(F)C=CC(c2ccc3c(c2)CN(CCCCCC(=O)NOCc2ccccc2)C3=O)C(F)=C1F |
| InChI | InChI=1S/C28H29F3N2O3/c1-28(31)14-13-22(25(29)26(28)30)20-11-12-23-21(16-20)17-33(27(23)35)15-7-3-6-10-24(34)32-36-18-19-8-4-2-5-9-19/h2,4-5,8-9,11-14,16,22H,3,6-7,10,15,17-18H2,1H3,(H,32,34) |
| InChIKey | KSRMDCSGBCCHIC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|