C32H26 — CID 87109712
1-cyclopenta-1,3-dien-1-yl-2,7-dimethyl-2,5-diphenylfluorene (PubChem CID 87109712) has the molecular formula C32H26 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-2,7-dimethyl-2,5-diphenylfluorene.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-2,7-dimethyl-2,5-diphenylfluorene |
|---|---|
| PubChem CID | 87109712 |
| Molecular Formula | C32H26 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-2,7-dimethyl-2,5-diphenylfluorene |
| SMILES | Cc1cc(-c2ccccc2)c2c(c1)=CC1=C(C3=CC=CC3)C(C)(c3ccccc3)C=CC=21 |
| InChI | InChI=1S/C32H26/c1-22-19-25-21-29-27(30(25)28(20-22)23-11-5-3-6-12-23)17-18-32(2,26-15-7-4-8-16-26)31(29)24-13-9-10-14-24/h3-13,15-21H,14H2,1-2H3 |
| InChIKey | FLNUQGCZVAVTCE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |