C16H26N6O5 — CID 87109770
[bis(hydroxymethylamino)methylamino]methanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87109770) has the molecular formula C16H26N6O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [bis(hydroxymethylamino)methylamino]methanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | [bis(hydroxymethylamino)methylamino]methanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87109770 |
| Molecular Formula | C16H26N6O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [bis(hydroxymethylamino)methylamino]methanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.OCNC(NCO)NCO |
| InChI | InChI=1S/C12H13N3O2.C4H13N3O3/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;8-1-5-4(6-2-9)7-3-10/h7H,1-6H2;4-10H,1-3H2 |
| InChIKey | BYPCLINKZSYCDM-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|