C17H22N4O5 — CID 8710993
N'-acetyl-2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]acetohydrazide (PubChem CID 8710993) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is N'-acetyl-2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]acetohydrazide.
| Compound Name | N'-acetyl-2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 8710993 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N'-acetyl-2-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CN1CCN(C(=O)[C@@H]2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C17H22N4O5/c1-12(22)18-19-16(23)10-20-6-8-21(9-7-20)17(24)15-11-25-13-4-2-3-5-14(13)26-15/h2-5,15H,6-11H2,1H3,(H,18,22)(H,19,23)/t15-/m0/s1 |
| InChIKey | MZSILLJYWOZOPM-HNNXBMFYSA-N |
| XLogP | -0.86 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|