About 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline
2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline (PubChem CID 871102) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline.
Molecular Properties
| Compound Name | 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline |
| PubChem CID | 871102 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline |
| SMILES | COc1cc(OC)c2nc(N3CCCCCC3)cc(C)c2c1 |
| InChI | InChI=1S/C18H24N2O2/c1-13-10-17(20-8-6-4-5-7-9-20)19-18-15(13)11-14(21-2)12-16(18)22-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | HOHKEMSJVUKZAV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline?
The IUPAC name of 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline (CID 871102) is 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline.
What is the SMILES notation for 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline?
The canonical SMILES for 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline is COc1cc(OC)c2nc(N3CCCCCC3)cc(C)c2c1.
What is the InChIKey of 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline?
The InChIKey is HOHKEMSJVUKZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-13-10-17(20-8-6-4-5-7-9-20)19-18-15(13)11-14(21-2)12-16(18)22-3/h10-12H,4-9H2,1-3H3.
What are the key properties of 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline?
2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline has a molecular weight of 300.40 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-yl)-6,8-dimethoxy-4-methylquinoline is sourced from PubChem (CID 871102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).